C24H29BN2O6 — CID 170813257
4-amino-3-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid (PubChem CID 170813257) has the molecular formula C24H29BN2O6 and a molecular weight of 452.32 g/mol. Its IUPAC name is 4-amino-3-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid.
| Compound Name | 4-amino-3-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 170813257 |
| Molecular Formula | C24H29BN2O6 |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 4-amino-3-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
| SMILES | CC1(C)OB(C(=Cc2cc(C(=O)O)ccc2N)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C24H29BN2O6/c1-23(2)24(3,4)33-25(32-23)19(13-18-12-17(21(28)29)10-11-20(18)26)14-27-22(30)31-15-16-8-6-5-7-9-16/h5-13H,14-15,26H2,1-4H3,(H,27,30)(H,28,29) |
| InChIKey | OMBIHHCAQCFDFE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|