C23H30BN3O4 — CID 170812509
benzyl N-[3-(5-amino-4-methyl-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170812509) has the molecular formula C23H30BN3O4 and a molecular weight of 423.32 g/mol. Its IUPAC name is benzyl N-[3-(5-amino-4-methyl-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(5-amino-4-methyl-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170812509 |
| Molecular Formula | C23H30BN3O4 |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | benzyl N-[3-(5-amino-4-methyl-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | Cc1cc(C=C(CNC(=O)OCc2ccccc2)B2OC(C)(C)C(C)(C)O2)ncc1N |
| InChI | InChI=1S/C23H30BN3O4/c1-16-11-19(26-14-20(16)25)12-18(24-30-22(2,3)23(4,5)31-24)13-27-21(28)29-15-17-9-7-6-8-10-17/h6-12,14H,13,15,25H2,1-5H3,(H,27,28) |
| InChIKey | JJAMHUHRRNLYMU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|