C24H28BN3O4 — CID 170812987
benzyl N-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170812987) has the molecular formula C24H28BN3O4 and a molecular weight of 433.32 g/mol. Its IUPAC name is benzyl N-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170812987 |
| Molecular Formula | C24H28BN3O4 |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | benzyl N-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cnc3[nH]ccc3c2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C24H28BN3O4/c1-23(2)24(3,4)32-25(31-23)20(13-18-12-19-10-11-26-21(19)27-14-18)15-28-22(29)30-16-17-8-6-5-7-9-17/h5-14H,15-16H2,1-4H3,(H,26,27)(H,28,29) |
| InChIKey | MZKFZNQMCBGWOD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|