C25H29BN2O4 — CID 170813001
benzyl N-[3-(1H-indol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813001) has the molecular formula C25H29BN2O4 and a molecular weight of 432.33 g/mol. Its IUPAC name is benzyl N-[3-(1H-indol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(1H-indol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813001 |
| Molecular Formula | C25H29BN2O4 |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | benzyl N-[3-(1H-indol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2ccc3[nH]ccc3c2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C25H29BN2O4/c1-24(2)25(3,4)32-26(31-24)21(15-19-10-11-22-20(14-19)12-13-27-22)16-28-23(29)30-17-18-8-6-5-7-9-18/h5-15,27H,16-17H2,1-4H3,(H,28,29) |
| InChIKey | GKWMZOINMWMMIV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|