C24H27BN2O5 — CID 170812965
benzyl N-[3-(4-cyano-3-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170812965) has the molecular formula C24H27BN2O5 and a molecular weight of 434.30 g/mol. Its IUPAC name is benzyl N-[3-(4-cyano-3-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(4-cyano-3-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170812965 |
| Molecular Formula | C24H27BN2O5 |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | benzyl N-[3-(4-cyano-3-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2ccc(C#N)c(O)c2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C24H27BN2O5/c1-23(2)24(3,4)32-25(31-23)20(12-18-10-11-19(14-26)21(28)13-18)15-27-22(29)30-16-17-8-6-5-7-9-17/h5-13,28H,15-16H2,1-4H3,(H,27,29) |
| InChIKey | VPDQZXKMMZVKCS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|