C21H29BN2O5 — CID 170809707
tert-butyl N-[3-(4-cyano-3-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809707) has the molecular formula C21H29BN2O5 and a molecular weight of 400.28 g/mol. Its IUPAC name is tert-butyl N-[3-(4-cyano-3-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-cyano-3-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809707 |
| Molecular Formula | C21H29BN2O5 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | tert-butyl N-[3-(4-cyano-3-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1ccc(C#N)c(O)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H29BN2O5/c1-19(2,3)27-18(26)24-13-16(22-28-20(4,5)21(6,7)29-22)10-14-8-9-15(12-23)17(25)11-14/h8-11,25H,13H2,1-7H3,(H,24,26) |
| InChIKey | DSNHROUJGMBNHS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|