C22H33BN2O5 — CID 170810016
tert-butyl N-[3-(3-acetyl-4-aminophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810016) has the molecular formula C22H33BN2O5 and a molecular weight of 416.33 g/mol. Its IUPAC name is tert-butyl N-[3-(3-acetyl-4-aminophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-acetyl-4-aminophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810016 |
| Molecular Formula | C22H33BN2O5 |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | tert-butyl N-[3-(3-acetyl-4-aminophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(=O)c1cc(C=C(CNC(=O)OC(C)(C)C)B2OC(C)(C)C(C)(C)O2)ccc1N |
| InChI | InChI=1S/C22H33BN2O5/c1-14(26)17-12-15(9-10-18(17)24)11-16(13-25-19(27)28-20(2,3)4)23-29-21(5,6)22(7,8)30-23/h9-12H,13,24H2,1-8H3,(H,25,27) |
| InChIKey | IPDAQHYGALFZHP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|