C27H35BN2O5 — CID 170810474
tert-butyl N-[3-(4-amino-3-benzoylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810474) has the molecular formula C27H35BN2O5 and a molecular weight of 478.40 g/mol. Its IUPAC name is tert-butyl N-[3-(4-amino-3-benzoylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-amino-3-benzoylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810474 |
| Molecular Formula | C27H35BN2O5 |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | tert-butyl N-[3-(4-amino-3-benzoylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1ccc(N)c(C(=O)c2ccccc2)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C27H35BN2O5/c1-25(2,3)33-24(32)30-17-20(28-34-26(4,5)27(6,7)35-28)15-18-13-14-22(29)21(16-18)23(31)19-11-9-8-10-12-19/h8-16H,17,29H2,1-7H3,(H,30,32) |
| InChIKey | QERXQYRCJXRZSG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|