C22H29BF3NO5 — CID 170810334
tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[3-(2,2,2-trifluoroacetyl)phenyl]prop-2-enyl]carbamate (PubChem CID 170810334) has the molecular formula C22H29BF3NO5 and a molecular weight of 455.28 g/mol. Its IUPAC name is tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[3-(2,2,2-trifluoroacetyl)phenyl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[3-(2,2,2-trifluoroacetyl)phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810334 |
| Molecular Formula | C22H29BF3NO5 |
| Molecular Weight | 455.28 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[3-(2,2,2-trifluoroacetyl)phenyl]prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1cccc(C(=O)C(F)(F)F)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H29BF3NO5/c1-19(2,3)30-18(29)27-13-16(23-31-20(4,5)21(6,7)32-23)12-14-9-8-10-15(11-14)17(28)22(24,25)26/h8-12H,13H2,1-7H3,(H,27,29) |
| InChIKey | QUTYBVJOHIFCDD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.28 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|