C21H32BNO4S — CID 170809110
tert-butyl N-[3-[3-(sulfanylmethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809110) has the molecular formula C21H32BNO4S and a molecular weight of 405.37 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(sulfanylmethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(sulfanylmethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809110 |
| Molecular Formula | C21H32BNO4S |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | tert-butyl N-[3-[3-(sulfanylmethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1cccc(CS)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H32BNO4S/c1-19(2,3)25-18(24)23-13-17(12-15-9-8-10-16(11-15)14-28)22-26-20(4,5)21(6,7)27-22/h8-12,28H,13-14H2,1-7H3,(H,23,24) |
| InChIKey | CRVUPCNFTPAOCW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|