C23H36BNO4 — CID 170809417
tert-butyl N-[3-(4-propylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809417) has the molecular formula C23H36BNO4 and a molecular weight of 401.36 g/mol. Its IUPAC name is tert-butyl N-[3-(4-propylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-propylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809417 |
| Molecular Formula | C23H36BNO4 |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | tert-butyl N-[3-(4-propylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CCCc1ccc(C=C(CNC(=O)OC(C)(C)C)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C23H36BNO4/c1-9-10-17-11-13-18(14-12-17)15-19(16-25-20(26)27-21(2,3)4)24-28-22(5,6)23(7,8)29-24/h11-15H,9-10,16H2,1-8H3,(H,25,26) |
| InChIKey | QLQBFUOSHNXKDT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|