C21H29BN2O4S — CID 170809612
tert-butyl N-[3-(4-isothiocyanatophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809612) has the molecular formula C21H29BN2O4S and a molecular weight of 416.35 g/mol. Its IUPAC name is tert-butyl N-[3-(4-isothiocyanatophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-isothiocyanatophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809612 |
| Molecular Formula | C21H29BN2O4S |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | tert-butyl N-[3-(4-isothiocyanatophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1ccc(N=C=S)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H29BN2O4S/c1-19(2,3)26-18(25)23-13-16(22-27-20(4,5)21(6,7)28-22)12-15-8-10-17(11-9-15)24-14-29/h8-12H,13H2,1-7H3,(H,23,25) |
| InChIKey | JGZQEZVLEHEJMF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|