C24H38BNO4 — CID 170809826
tert-butyl N-[3-[4-(2-methylpropyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809826) has the molecular formula C24H38BNO4 and a molecular weight of 415.38 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(2-methylpropyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(2-methylpropyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809826 |
| Molecular Formula | C24H38BNO4 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | tert-butyl N-[3-[4-(2-methylpropyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)Cc1ccc(C=C(CNC(=O)OC(C)(C)C)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C24H38BNO4/c1-17(2)14-18-10-12-19(13-11-18)15-20(16-26-21(27)28-22(3,4)5)25-29-23(6,7)24(8,9)30-25/h10-13,15,17H,14,16H2,1-9H3,(H,26,27) |
| InChIKey | WVEJIKYEFATXBV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|