C34H40BNO4 — CID 170811455
9H-fluoren-9-ylmethyl N-[3-[4-(2-methylpropyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170811455) has the molecular formula C34H40BNO4 and a molecular weight of 537.51 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[4-(2-methylpropyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[4-(2-methylpropyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170811455 |
| Molecular Formula | C34H40BNO4 |
| Molecular Weight | 537.51 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[4-(2-methylpropyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)Cc1ccc(C=C(CNC(=O)OCC2c3ccccc3-c3ccccc32)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C34H40BNO4/c1-23(2)19-24-15-17-25(18-16-24)20-26(35-39-33(3,4)34(5,6)40-35)21-36-32(37)38-22-31-29-13-9-7-11-27(29)28-12-8-10-14-30(28)31/h7-18,20,23,31H,19,21-22H2,1-6H3,(H,36,37) |
| InChIKey | MDVIUPQRNJITLS-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.51 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|