C31H34BN3O4S — CID 170811571
9H-fluoren-9-ylmethyl N-[3-[4-(carbamothioylamino)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170811571) has the molecular formula C31H34BN3O4S and a molecular weight of 555.51 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[4-(carbamothioylamino)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[4-(carbamothioylamino)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170811571 |
| Molecular Formula | C31H34BN3O4S |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[4-(carbamothioylamino)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2ccc(NC(N)=S)cc2)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C31H34BN3O4S/c1-30(2)31(3,4)39-32(38-30)21(17-20-13-15-22(16-14-20)35-28(33)40)18-34-29(36)37-19-27-25-11-7-5-9-23(25)24-10-6-8-12-26(24)27/h5-17,27H,18-19H2,1-4H3,(H,34,36)(H3,33,35,40) |
| InChIKey | SICYTGPIOAEYOJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|