C32H35BN2O8S — CID 170812071
2-[[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]sulfonylamino]acetic acid (PubChem CID 170812071) has the molecular formula C32H35BN2O8S and a molecular weight of 618.52 g/mol. Its IUPAC name is 2-[[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]sulfonylamino]acetic acid.
| Compound Name | 2-[[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 170812071 |
| Molecular Formula | C32H35BN2O8S |
| Molecular Weight | 618.52 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | 2-[[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]sulfonylamino]acetic acid |
| SMILES | CC1(C)OB(C(=Cc2ccc(S(=O)(=O)NCC(=O)O)cc2)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C32H35BN2O8S/c1-31(2)32(3,4)43-33(42-31)22(17-21-13-15-23(16-14-21)44(39,40)35-19-29(36)37)18-34-30(38)41-20-28-26-11-7-5-9-24(26)25-10-6-8-12-27(25)28/h5-17,28,35H,18-20H2,1-4H3,(H,34,38)(H,36,37) |
| InChIKey | HTXGALXCKSXWSG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|