C33H34BNO6 — CID 170811713
(E)-3-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 170811713) has the molecular formula C33H34BNO6 and a molecular weight of 551.45 g/mol. Its IUPAC name is (E)-3-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170811713 |
| Molecular Formula | C33H34BNO6 |
| Molecular Weight | 551.45 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | (E)-3-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC1(C)OB(C(=Cc2ccc(/C=C/C(=O)O)cc2)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C33H34BNO6/c1-32(2)33(3,4)41-34(40-32)24(19-23-15-13-22(14-16-23)17-18-30(36)37)20-35-31(38)39-21-29-27-11-7-5-9-25(27)26-10-6-8-12-28(26)29/h5-19,29H,20-21H2,1-4H3,(H,35,38)(H,36,37)/b18-17+,24-19? |
| InChIKey | QGOCWMJFVOZPSH-WPFRWFPDSA-N |
| XLogP | 6.34 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.45 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|