C35H34BNO7 — CID 170812078
5-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]furan-2-carboxylic acid (PubChem CID 170812078) has the molecular formula C35H34BNO7 and a molecular weight of 591.47 g/mol. Its IUPAC name is 5-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]furan-2-carboxylic acid.
| Compound Name | 5-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 170812078 |
| Molecular Formula | C35H34BNO7 |
| Molecular Weight | 591.47 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | 5-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]furan-2-carboxylic acid |
| SMILES | CC1(C)OB(C(=Cc2ccc(-c3ccc(C(=O)O)o3)cc2)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C35H34BNO7/c1-34(2)35(3,4)44-36(43-34)24(19-22-13-15-23(16-14-22)30-17-18-31(42-30)32(38)39)20-37-33(40)41-21-29-27-11-7-5-9-25(27)26-10-6-8-12-28(26)29/h5-19,29H,20-21H2,1-4H3,(H,37,40)(H,38,39) |
| InChIKey | UJWZEAQFJAEJBM-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.47 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|