C29H30BNO7 — CID 170810849
5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]furan-2-carboxylic acid (PubChem CID 170810849) has the molecular formula C29H30BNO7 and a molecular weight of 515.37 g/mol. Its IUPAC name is 5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]furan-2-carboxylic acid.
| Compound Name | 5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 170810849 |
| Molecular Formula | C29H30BNO7 |
| Molecular Weight | 515.37 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]furan-2-carboxylic acid |
| SMILES | CC1(C)OB(C(=Cc2ccc(C(=O)O)o2)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C29H30BNO7/c1-28(2)29(3,4)38-30(37-28)18(15-19-13-14-25(36-19)26(32)33)16-31-27(34)35-17-24-22-11-7-5-9-20(22)21-10-6-8-12-23(21)24/h5-15,24H,16-17H2,1-4H3,(H,31,34)(H,32,33) |
| InChIKey | XHULCBJDLDRAMD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.37 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|