C33H38BNO4 — CID 170811050
9H-fluoren-9-ylmethyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,5-trimethylphenyl)prop-2-enyl]carbamate (PubChem CID 170811050) has the molecular formula C33H38BNO4 and a molecular weight of 523.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,5-trimethylphenyl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,5-trimethylphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170811050 |
| Molecular Formula | C33H38BNO4 |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,5-trimethylphenyl)prop-2-enyl]carbamate |
| SMILES | Cc1cc(C)c(C=C(CNC(=O)OCC2c3ccccc3-c3ccccc32)B2OC(C)(C)C(C)(C)O2)cc1C |
| InChI | InChI=1S/C33H38BNO4/c1-21-16-23(3)24(17-22(21)2)18-25(34-38-32(4,5)33(6,7)39-34)19-35-31(36)37-20-30-28-14-10-8-12-26(28)27-13-9-11-15-29(27)30/h8-18,30H,19-20H2,1-7H3,(H,35,36) |
| InChIKey | MRSVXSOOYUXDFA-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|