C31H33BN2O5 — CID 170811316
9H-fluoren-9-ylmethyl N-[3-[2-(hydroxyiminomethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170811316) has the molecular formula C31H33BN2O5 and a molecular weight of 524.43 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[2-(hydroxyiminomethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[2-(hydroxyiminomethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170811316 |
| Molecular Formula | C31H33BN2O5 |
| Molecular Weight | 524.43 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[2-(hydroxyiminomethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2ccccc2C=NO)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C31H33BN2O5/c1-30(2)31(3,4)39-32(38-30)23(17-21-11-5-6-12-22(21)18-34-36)19-33-29(35)37-20-28-26-15-9-7-13-24(26)25-14-8-10-16-27(25)28/h5-18,28,36H,19-20H2,1-4H3,(H,33,35) |
| InChIKey | WBJBAEMCEXVGQL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|