C31H33BBrNO4 — CID 170812127
9H-fluoren-9-ylmethyl N-[3-[2-(bromomethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170812127) has the molecular formula C31H33BBrNO4 and a molecular weight of 574.32 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[2-(bromomethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[2-(bromomethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170812127 |
| Molecular Formula | C31H33BBrNO4 |
| Molecular Weight | 574.32 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[2-(bromomethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2ccccc2CBr)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C31H33BBrNO4/c1-30(2)31(3,4)38-32(37-30)23(17-21-11-5-6-12-22(21)18-33)19-34-29(35)36-20-28-26-15-9-7-13-24(26)25-14-8-10-16-27(25)28/h5-17,28H,18-20H2,1-4H3,(H,34,35) |
| InChIKey | IUGFYTYSCBEPQJ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.32 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|