C31H33BN2O6 — CID 170811641
2-amino-6-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid (PubChem CID 170811641) has the molecular formula C31H33BN2O6 and a molecular weight of 540.43 g/mol. Its IUPAC name is 2-amino-6-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid.
| Compound Name | 2-amino-6-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 170811641 |
| Molecular Formula | C31H33BN2O6 |
| Molecular Weight | 540.43 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 2-amino-6-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
| SMILES | CC1(C)OB(C(=Cc2cccc(N)c2C(=O)O)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C31H33BN2O6/c1-30(2)31(3,4)40-32(39-30)20(16-19-10-9-15-26(33)27(19)28(35)36)17-34-29(37)38-18-25-23-13-7-5-11-21(23)22-12-6-8-14-24(22)25/h5-16,25H,17-18,33H2,1-4H3,(H,34,37)(H,35,36) |
| InChIKey | JLDLYEANDQEKFC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.43 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|