C30H30BClN2O6 — CID 170811606
6-chloro-3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2-carboxylic acid (PubChem CID 170811606) has the molecular formula C30H30BClN2O6 and a molecular weight of 560.84 g/mol. Its IUPAC name is 6-chloro-3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 170811606 |
| Molecular Formula | C30H30BClN2O6 |
| Molecular Weight | 560.84 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | 6-chloro-3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2-carboxylic acid |
| SMILES | CC1(C)OB(C(=Cc2ccc(Cl)nc2C(=O)O)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C30H30BClN2O6/c1-29(2)30(3,4)40-31(39-29)19(15-18-13-14-25(32)34-26(18)27(35)36)16-33-28(37)38-17-24-22-11-7-5-9-20(22)21-10-6-8-12-23(21)24/h5-15,24H,16-17H2,1-4H3,(H,33,37)(H,35,36) |
| InChIKey | IHCSTUJSLHEGAE-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.84 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|