C28H30BClN4O4 — CID 170811011
9H-fluoren-9-ylmethyl N-[3-(4-amino-2-chloropyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170811011) has the molecular formula C28H30BClN4O4 and a molecular weight of 532.84 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(4-amino-2-chloropyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(4-amino-2-chloropyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170811011 |
| Molecular Formula | C28H30BClN4O4 |
| Molecular Weight | 532.84 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(4-amino-2-chloropyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cnc(Cl)nc2N)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C28H30BClN4O4/c1-27(2)28(3,4)38-29(37-27)18(13-17-14-32-25(30)34-24(17)31)15-33-26(35)36-16-23-21-11-7-5-9-19(21)20-10-6-8-12-22(20)23/h5-14,23H,15-16H2,1-4H3,(H,33,35)(H2,31,32,34) |
| InChIKey | XUPQZFKTULHUOJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.84 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|