C31H35BN2O4 — CID 170810947
9H-fluoren-9-ylmethyl N-[3-(2-amino-5-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810947) has the molecular formula C31H35BN2O4 and a molecular weight of 510.44 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2-amino-5-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2-amino-5-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810947 |
| Molecular Formula | C31H35BN2O4 |
| Molecular Weight | 510.44 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2-amino-5-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | Cc1ccc(N)c(C=C(CNC(=O)OCC2c3ccccc3-c3ccccc32)B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C31H35BN2O4/c1-20-14-15-28(33)21(16-20)17-22(32-37-30(2,3)31(4,5)38-32)18-34-29(35)36-19-27-25-12-8-6-10-23(25)24-11-7-9-13-26(24)27/h6-17,27H,18-19,33H2,1-5H3,(H,34,35) |
| InChIKey | LSWVJBOEKACSJV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.44 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|