C30H34BN3O4 — CID 170810887
9H-fluoren-9-ylmethyl N-[3-(6-amino-4-methyl-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810887) has the molecular formula C30H34BN3O4 and a molecular weight of 511.43 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(6-amino-4-methyl-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(6-amino-4-methyl-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810887 |
| Molecular Formula | C30H34BN3O4 |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(6-amino-4-methyl-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | Cc1cc(N)nc(C=C(CNC(=O)OCC2c3ccccc3-c3ccccc32)B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C30H34BN3O4/c1-19-14-21(34-27(32)15-19)16-20(31-37-29(2,3)30(4,5)38-31)17-33-28(35)36-18-26-24-12-8-6-10-22(24)23-11-7-9-13-25(23)26/h6-16,26H,17-18H2,1-5H3,(H2,32,34)(H,33,35) |
| InChIKey | UDRCUBJCDCQBGE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|