C29H33BN2O4S — CID 170810696
9H-fluoren-9-ylmethyl N-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810696) has the molecular formula C29H33BN2O4S and a molecular weight of 516.47 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810696 |
| Molecular Formula | C29H33BN2O4S |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | Cc1nc(C)c(C=C(CNC(=O)OCC2c3ccccc3-c3ccccc32)B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C29H33BN2O4S/c1-18-26(37-19(2)32-18)15-20(30-35-28(3,4)29(5,6)36-30)16-31-27(33)34-17-25-23-13-9-7-11-21(23)22-12-8-10-14-24(22)25/h7-15,25H,16-17H2,1-6H3,(H,31,33) |
| InChIKey | VKVGQGZNKNZQOQ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|