C30H33BN2O6S — CID 170811619
ethyl 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylate (PubChem CID 170811619) has the molecular formula C30H33BN2O6S and a molecular weight of 560.48 g/mol. Its IUPAC name is ethyl 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 170811619 |
| Molecular Formula | C30H33BN2O6S |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | ethyl 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(C=C(CNC(=O)OCC2c3ccccc3-c3ccccc32)B2OC(C)(C)C(C)(C)O2)n1 |
| InChI | InChI=1S/C30H33BN2O6S/c1-6-36-27(34)25-18-40-26(33-25)15-19(31-38-29(2,3)30(4,5)39-31)16-32-28(35)37-17-24-22-13-9-7-11-20(22)21-12-8-10-14-23(21)24/h7-15,18,24H,6,16-17H2,1-5H3,(H,32,35) |
| InChIKey | NFHOTHZJKFTLJC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|