C31H33BN2O6 — CID 170811633
methyl 6-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2-carboxylate (PubChem CID 170811633) has the molecular formula C31H33BN2O6 and a molecular weight of 540.43 g/mol. Its IUPAC name is methyl 6-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 170811633 |
| Molecular Formula | C31H33BN2O6 |
| Molecular Weight | 540.43 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | methyl 6-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(C=C(CNC(=O)OCC2c3ccccc3-c3ccccc32)B2OC(C)(C)C(C)(C)O2)n1 |
| InChI | InChI=1S/C31H33BN2O6/c1-30(2)31(3,4)40-32(39-30)20(17-21-11-10-16-27(34-21)28(35)37-5)18-33-29(36)38-19-26-24-14-8-6-12-22(24)23-13-7-9-15-25(23)26/h6-17,26H,18-19H2,1-5H3,(H,33,36) |
| InChIKey | SNUFWXVOQKGWBE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|