C28H29BN2O6S — CID 170810974
2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 170810974) has the molecular formula C28H29BN2O6S and a molecular weight of 532.43 g/mol. Its IUPAC name is 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 170810974 |
| Molecular Formula | C28H29BN2O6S |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC1(C)OB(C(=Cc2nc(C(=O)O)cs2)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C28H29BN2O6S/c1-27(2)28(3,4)37-29(36-27)17(13-24-31-23(16-38-24)25(32)33)14-30-26(34)35-15-22-20-11-7-5-9-18(20)19-10-6-8-12-21(19)22/h5-13,16,22H,14-15H2,1-4H3,(H,30,34)(H,32,33) |
| InChIKey | XMVPBYPNGHPBPQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|