C30H33BN2O5 — CID 170811002
9H-fluoren-9-ylmethyl N-[3-(5-methoxy-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170811002) has the molecular formula C30H33BN2O5 and a molecular weight of 512.42 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(5-methoxy-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(5-methoxy-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170811002 |
| Molecular Formula | C30H33BN2O5 |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(5-methoxy-2-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | COc1ccc(C=C(CNC(=O)OCC2c3ccccc3-c3ccccc32)B2OC(C)(C)C(C)(C)O2)nc1 |
| InChI | InChI=1S/C30H33BN2O5/c1-29(2)30(3,4)38-31(37-29)20(16-21-14-15-22(35-5)18-32-21)17-33-28(34)36-19-27-25-12-8-6-10-23(25)24-11-7-9-13-26(24)27/h6-16,18,27H,17,19H2,1-5H3,(H,33,34) |
| InChIKey | DGOMJOLTPUMMTL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|