C32H34BNO6 — CID 170811492
9H-fluoren-9-ylmethyl N-[3-(2-formyl-5-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170811492) has the molecular formula C32H34BNO6 and a molecular weight of 539.44 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2-formyl-5-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2-formyl-5-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170811492 |
| Molecular Formula | C32H34BNO6 |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2-formyl-5-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | COc1ccc(C=O)c(C=C(CNC(=O)OCC2c3ccccc3-c3ccccc32)B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C32H34BNO6/c1-31(2)32(3,4)40-33(39-31)23(16-22-17-24(37-5)15-14-21(22)19-35)18-34-30(36)38-20-29-27-12-8-6-10-25(27)26-11-7-9-13-28(26)29/h6-17,19,29H,18,20H2,1-5H3,(H,34,36) |
| InChIKey | VQTYELWEMUFXKS-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|