C31H30BF2NO5 — CID 170811554
9H-fluoren-9-ylmethyl N-[3-(2,5-difluoro-4-formylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170811554) has the molecular formula C31H30BF2NO5 and a molecular weight of 545.39 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2,5-difluoro-4-formylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2,5-difluoro-4-formylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170811554 |
| Molecular Formula | C31H30BF2NO5 |
| Molecular Weight | 545.39 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2,5-difluoro-4-formylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cc(F)c(C=O)cc2F)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C31H30BF2NO5/c1-30(2)31(3,4)40-32(39-30)21(13-19-14-28(34)20(17-36)15-27(19)33)16-35-29(37)38-18-26-24-11-7-5-9-22(24)23-10-6-8-12-25(23)26/h5-15,17,26H,16,18H2,1-4H3,(H,35,37) |
| InChIKey | LHURVMNBEVHMER-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.39 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|