C30H33BFN3O4 — CID 170811179
9H-fluoren-9-ylmethyl N-[3-(2,3-diamino-5-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170811179) has the molecular formula C30H33BFN3O4 and a molecular weight of 529.42 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2,3-diamino-5-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2,3-diamino-5-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170811179 |
| Molecular Formula | C30H33BFN3O4 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2,3-diamino-5-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cc(F)cc(N)c2N)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C30H33BFN3O4/c1-29(2)30(3,4)39-31(38-29)19(13-18-14-20(32)15-26(33)27(18)34)16-35-28(36)37-17-25-23-11-7-5-9-21(23)22-10-6-8-12-24(22)25/h5-15,25H,16-17,33-34H2,1-4H3,(H,35,36) |
| InChIKey | VCSJXOVROXBYCU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|