C30H32BFN2O4 — CID 170810908
9H-fluoren-9-ylmethyl N-[3-(5-amino-2-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810908) has the molecular formula C30H32BFN2O4 and a molecular weight of 514.41 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(5-amino-2-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(5-amino-2-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810908 |
| Molecular Formula | C30H32BFN2O4 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(5-amino-2-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cc(N)ccc2F)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C30H32BFN2O4/c1-29(2)30(3,4)38-31(37-29)20(15-19-16-21(33)13-14-27(19)32)17-34-28(35)36-18-26-24-11-7-5-9-22(24)23-10-6-8-12-25(23)26/h5-16,26H,17-18,33H2,1-4H3,(H,34,35) |
| InChIKey | VADUVGLRKRUZBJ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|