C30H31BFNO5 — CID 170810819
9H-fluoren-9-ylmethyl N-[3-(4-fluoro-2-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810819) has the molecular formula C30H31BFNO5 and a molecular weight of 515.39 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(4-fluoro-2-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(4-fluoro-2-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810819 |
| Molecular Formula | C30H31BFNO5 |
| Molecular Weight | 515.39 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(4-fluoro-2-hydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2ccc(F)cc2O)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C30H31BFNO5/c1-29(2)30(3,4)38-31(37-29)20(15-19-13-14-21(32)16-27(19)34)17-33-28(35)36-18-26-24-11-7-5-9-22(24)23-10-6-8-12-25(23)26/h5-16,26,34H,17-18H2,1-4H3,(H,33,35) |
| InChIKey | RWFNXIROXRIUDB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.39 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|