C28H32BN3O4 — CID 170810621
9H-fluoren-9-ylmethyl N-[3-(3-methylimidazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810621) has the molecular formula C28H32BN3O4 and a molecular weight of 485.39 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(3-methylimidazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(3-methylimidazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810621 |
| Molecular Formula | C28H32BN3O4 |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(3-methylimidazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | Cn1cncc1C=C(CNC(=O)OCC1c2ccccc2-c2ccccc21)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C28H32BN3O4/c1-27(2)28(3,4)36-29(35-27)19(14-20-16-30-18-32(20)5)15-31-26(33)34-17-25-23-12-8-6-10-21(23)22-11-7-9-13-24(22)25/h6-14,16,18,25H,15,17H2,1-5H3,(H,31,33) |
| InChIKey | SQGPJSAVDLLLFC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|