C30H36BN3O4 — CID 170810875
9H-fluoren-9-ylmethyl N-[3-(1-propan-2-ylpyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810875) has the molecular formula C30H36BN3O4 and a molecular weight of 513.45 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(1-propan-2-ylpyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(1-propan-2-ylpyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810875 |
| Molecular Formula | C30H36BN3O4 |
| Molecular Weight | 513.45 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(1-propan-2-ylpyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)n1cc(C=C(CNC(=O)OCC2c3ccccc3-c3ccccc32)B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C30H36BN3O4/c1-20(2)34-18-21(16-33-34)15-22(31-37-29(3,4)30(5,6)38-31)17-32-28(35)36-19-27-25-13-9-7-11-23(25)24-12-8-10-14-26(24)27/h7-16,18,20,27H,17,19H2,1-6H3,(H,32,35) |
| InChIKey | VVJVSUHVVQVEKJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.45 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|