C31H31BF3NO5 — CID 170811742
9H-fluoren-9-ylmethyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(trifluoromethoxy)phenyl]prop-2-enyl]carbamate (PubChem CID 170811742) has the molecular formula C31H31BF3NO5 and a molecular weight of 565.40 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(trifluoromethoxy)phenyl]prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(trifluoromethoxy)phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170811742 |
| Molecular Formula | C31H31BF3NO5 |
| Molecular Weight | 565.40 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(trifluoromethoxy)phenyl]prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2ccc(OC(F)(F)F)cc2)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C31H31BF3NO5/c1-29(2)30(3,4)41-32(40-29)21(17-20-13-15-22(16-14-20)39-31(33,34)35)18-36-28(37)38-19-27-25-11-7-5-9-23(25)24-10-6-8-12-26(24)27/h5-17,27H,18-19H2,1-4H3,(H,36,37) |
| InChIKey | MRBHAUKAUKBDTA-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.40 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|