C15H22BNO5S — CID 170801845
ethyl 2-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylate (PubChem CID 170801845) has the molecular formula C15H22BNO5S and a molecular weight of 339.22 g/mol. Its IUPAC name is ethyl 2-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 170801845 |
| Molecular Formula | C15H22BNO5S |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | ethyl 2-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(C=C(CO)B2OC(C)(C)C(C)(C)O2)n1 |
| InChI | InChI=1S/C15H22BNO5S/c1-6-20-13(19)11-9-23-12(17-11)7-10(8-18)16-21-14(2,3)15(4,5)22-16/h7,9,18H,6,8H2,1-5H3 |
| InChIKey | GIAXIGFBKRECTB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|