C13H19BN2O4S — CID 170806087
2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 170806087) has the molecular formula C13H19BN2O4S and a molecular weight of 310.18 g/mol. Its IUPAC name is 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 170806087 |
| Molecular Formula | C13H19BN2O4S |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC1(C)OB(C(=Cc2nc(C(=O)O)cs2)CN)OC1(C)C |
| InChI | InChI=1S/C13H19BN2O4S/c1-12(2)13(3,4)20-14(19-12)8(6-15)5-10-16-9(7-21-10)11(17)18/h5,7H,6,15H2,1-4H3,(H,17,18) |
| InChIKey | IPBJHFRNWICWGA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|