C15H20BClN2O4 — CID 170806729
5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-6-chloropyridine-3-carboxylic acid (PubChem CID 170806729) has the molecular formula C15H20BClN2O4 and a molecular weight of 338.60 g/mol. Its IUPAC name is 5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-6-chloropyridine-3-carboxylic acid.
| Compound Name | 5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-6-chloropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 170806729 |
| Molecular Formula | C15H20BClN2O4 |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-6-chloropyridine-3-carboxylic acid |
| SMILES | CC1(C)OB(C(=Cc2cc(C(=O)O)cnc2Cl)CN)OC1(C)C |
| InChI | InChI=1S/C15H20BClN2O4/c1-14(2)15(3,4)23-16(22-14)11(7-18)6-9-5-10(13(20)21)8-19-12(9)17/h5-6,8H,7,18H2,1-4H3,(H,20,21) |
| InChIKey | OOWDJZMBIRVBOX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|