C16H21BClNO4 — CID 170806587
3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-chlorobenzoic acid (PubChem CID 170806587) has the molecular formula C16H21BClNO4 and a molecular weight of 337.61 g/mol. Its IUPAC name is 3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-chlorobenzoic acid.
| Compound Name | 3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-chlorobenzoic acid |
|---|---|
| PubChem CID | 170806587 |
| Molecular Formula | C16H21BClNO4 |
| Molecular Weight | 337.61 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-chlorobenzoic acid |
| SMILES | CC1(C)OB(C(=Cc2cc(Cl)cc(C(=O)O)c2)CN)OC1(C)C |
| InChI | InChI=1S/C16H21BClNO4/c1-15(2)16(3,4)23-17(22-15)12(9-19)6-10-5-11(14(20)21)8-13(18)7-10/h5-8H,9,19H2,1-4H3,(H,20,21) |
| InChIKey | JUCSQTBOAYPABK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.61 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|