C19H28BNO4 — CID 170807071
2-[4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]-2-methylpropanoic acid (PubChem CID 170807071) has the molecular formula C19H28BNO4 and a molecular weight of 345.25 g/mol. Its IUPAC name is 2-[4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 170807071 |
| Molecular Formula | C19H28BNO4 |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 2-[4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1ccc(C=C(CN)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C19H28BNO4/c1-17(2,16(22)23)14-9-7-13(8-10-14)11-15(12-21)20-24-18(3,4)19(5,6)25-20/h7-11H,12,21H2,1-6H3,(H,22,23) |
| InChIKey | DJCMAOMRMXXMTB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|