C19H30BNO2 — CID 170806568
3-[4-(2-methylpropyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170806568) has the molecular formula C19H30BNO2 and a molecular weight of 315.27 g/mol. Its IUPAC name is 3-[4-(2-methylpropyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | 3-[4-(2-methylpropyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170806568 |
| Molecular Formula | C19H30BNO2 |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 3-[4-(2-methylpropyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | CC(C)Cc1ccc(C=C(CN)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C19H30BNO2/c1-14(2)11-15-7-9-16(10-8-15)12-17(13-21)20-22-18(3,4)19(5,6)23-20/h7-10,12,14H,11,13,21H2,1-6H3 |
| InChIKey | RJCJNUVXZYZTCH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|