C17H23BN2O2 — CID 170806373
2-[4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetonitrile (PubChem CID 170806373) has the molecular formula C17H23BN2O2 and a molecular weight of 298.20 g/mol. Its IUPAC name is 2-[4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetonitrile.
| Compound Name | 2-[4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 170806373 |
| Molecular Formula | C17H23BN2O2 |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-[4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetonitrile |
| SMILES | CC1(C)OB(C(=Cc2ccc(CC#N)cc2)CN)OC1(C)C |
| InChI | InChI=1S/C17H23BN2O2/c1-16(2)17(3,4)22-18(21-16)15(12-20)11-14-7-5-13(6-8-14)9-10-19/h5-8,11H,9,12,20H2,1-4H3 |
| InChIKey | HWBGWAGHPKJWEV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|