C16H22BNO3 — CID 170805944
4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzaldehyde (PubChem CID 170805944) has the molecular formula C16H22BNO3 and a molecular weight of 287.17 g/mol. Its IUPAC name is 4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzaldehyde.
| Compound Name | 4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzaldehyde |
|---|---|
| PubChem CID | 170805944 |
| Molecular Formula | C16H22BNO3 |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzaldehyde |
| SMILES | CC1(C)OB(C(=Cc2ccc(C=O)cc2)CN)OC1(C)C |
| InChI | InChI=1S/C16H22BNO3/c1-15(2)16(3,4)21-17(20-15)14(10-18)9-12-5-7-13(11-19)8-6-12/h5-9,11H,10,18H2,1-4H3 |
| InChIKey | TZTOOHPBSPOZKQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|