C19H25BO6S — CID 170805245
3-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-methoxybenzoic acid (PubChem CID 170805245) has the molecular formula C19H25BO6S and a molecular weight of 392.28 g/mol. Its IUPAC name is 3-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-methoxybenzoic acid.
| Compound Name | 3-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 170805245 |
| Molecular Formula | C19H25BO6S |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 3-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-methoxybenzoic acid |
| SMILES | COc1cc(C=C(CSC(C)=O)B2OC(C)(C)C(C)(C)O2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C19H25BO6S/c1-12(21)27-11-15(20-25-18(2,3)19(4,5)26-20)8-13-7-14(17(22)23)10-16(9-13)24-6/h7-10H,11H2,1-6H3,(H,22,23) |
| InChIKey | VACKWSNUHJOSOJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|