C22H31BO5S — CID 170805513
tert-butyl 3-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate (PubChem CID 170805513) has the molecular formula C22H31BO5S and a molecular weight of 418.36 g/mol. Its IUPAC name is tert-butyl 3-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate.
| Compound Name | tert-butyl 3-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 170805513 |
| Molecular Formula | C22H31BO5S |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | tert-butyl 3-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate |
| SMILES | CC(=O)SCC(=Cc1cccc(C(=O)OC(C)(C)C)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H31BO5S/c1-15(24)29-14-18(23-27-21(5,6)22(7,8)28-23)13-16-10-9-11-17(12-16)19(25)26-20(2,3)4/h9-13H,14H2,1-8H3 |
| InChIKey | SJEDUVCPTKUERL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|